C18H30N2O2S — CID 141417025
N-[3-[2-(tert-butylamino)ethoxy]phenyl]cyclohexanesulfinamide (PubChem CID 141417025) has the molecular formula C18H30N2O2S and a molecular weight of 338.52 g/mol. Its IUPAC name is N-[3-[2-(tert-butylamino)ethoxy]phenyl]cyclohexanesulfinamide.
| Compound Name | N-[3-[2-(tert-butylamino)ethoxy]phenyl]cyclohexanesulfinamide |
|---|---|
| PubChem CID | 141417025 |
| Molecular Formula | C18H30N2O2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[3-[2-(tert-butylamino)ethoxy]phenyl]cyclohexanesulfinamide |
| SMILES | CC(C)(C)NCCOc1cccc(NS(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C18H30N2O2S/c1-18(2,3)19-12-13-22-16-9-7-8-15(14-16)20-23(21)17-10-5-4-6-11-17/h7-9,14,17,19-20H,4-6,10-13H2,1-3H3 |
| InChIKey | UOFRPGISZXBDAC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|