C15H13N3O2 — CID 141417395
4-[7-(methylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid (PubChem CID 141417395) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-[7-(methylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid.
| Compound Name | 4-[7-(methylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 141417395 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-[7-(methylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid |
| SMILES | CNc1ccn2cc(-c3ccc(C(=O)O)cc3)nc2c1 |
| InChI | InChI=1S/C15H13N3O2/c1-16-12-6-7-18-9-13(17-14(18)8-12)10-2-4-11(5-3-10)15(19)20/h2-9,16H,1H3,(H,19,20) |
| InChIKey | JBVWUXZBSMOUEM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |