C19H22N4 — CID 86280801
N-methyl-2-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyridin-7-amine (PubChem CID 86280801) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-methyl-2-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyridin-7-amine.
| Compound Name | N-methyl-2-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyridin-7-amine |
|---|---|
| PubChem CID | 86280801 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-methyl-2-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyridin-7-amine |
| SMILES | CNc1ccn2cc(-c3ccc(N4CCCCC4)cc3)nc2c1 |
| InChI | InChI=1S/C19H22N4/c1-20-16-9-12-23-14-18(21-19(23)13-16)15-5-7-17(8-6-15)22-10-3-2-4-11-22/h5-9,12-14,20H,2-4,10-11H2,1H3 |
| InChIKey | JHTXFVTZSHVMFX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |