C8H11N3O2 — CID 141419529
methyl 1,2,3,5-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylate (PubChem CID 141419529) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 1,2,3,5-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylate.
| Compound Name | methyl 1,2,3,5-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 141419529 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | methyl 1,2,3,5-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylate |
| SMILES | COC(=O)C1=C2NNCN2CC=C1 |
| InChI | InChI=1S/C8H11N3O2/c1-13-8(12)6-3-2-4-11-5-9-10-7(6)11/h2-3,9-10H,4-5H2,1H3 |
| InChIKey | FJDPRXZGOQFWBM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |