C18H18N4O2 — CID 141419886
6-(6-methoxy-3-pyridinyl)-4-[(3S)-pyrrolidin-3-yl]oxyquinazoline (PubChem CID 141419886) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 6-(6-methoxy-3-pyridinyl)-4-[(3S)-pyrrolidin-3-yl]oxyquinazoline.
| Compound Name | 6-(6-methoxy-3-pyridinyl)-4-[(3S)-pyrrolidin-3-yl]oxyquinazoline |
|---|---|
| PubChem CID | 141419886 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 6-(6-methoxy-3-pyridinyl)-4-[(3S)-pyrrolidin-3-yl]oxyquinazoline |
| SMILES | COc1ccc(-c2ccc3ncnc(O[C@H]4CCNC4)c3c2)cn1 |
| InChI | InChI=1S/C18H18N4O2/c1-23-17-5-3-13(9-20-17)12-2-4-16-15(8-12)18(22-11-21-16)24-14-6-7-19-10-14/h2-5,8-9,11,14,19H,6-7,10H2,1H3/t14-/m0/s1 |
| InChIKey | XSRAALSSFJSHMZ-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |