C12H15N3OS — CID 62348094
6-ethyl-4-pyrrolidin-3-yloxythieno[2,3-d]pyrimidine (PubChem CID 62348094) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 6-ethyl-4-pyrrolidin-3-yloxythieno[2,3-d]pyrimidine.
| Compound Name | 6-ethyl-4-pyrrolidin-3-yloxythieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 62348094 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 6-ethyl-4-pyrrolidin-3-yloxythieno[2,3-d]pyrimidine |
| SMILES | CCc1cc2c(OC3CCNC3)ncnc2s1 |
| InChI | InChI=1S/C12H15N3OS/c1-2-9-5-10-11(14-7-15-12(10)17-9)16-8-3-4-13-6-8/h5,7-8,13H,2-4,6H2,1H3 |
| InChIKey | CHCSWNIWPGHAFM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |