C13H17N3OS — CID 63617901
4-(6-methylthieno[2,3-d]pyrimidin-4-yl)oxycyclohexan-1-amine (PubChem CID 63617901) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 4-(6-methylthieno[2,3-d]pyrimidin-4-yl)oxycyclohexan-1-amine.
| Compound Name | 4-(6-methylthieno[2,3-d]pyrimidin-4-yl)oxycyclohexan-1-amine |
|---|---|
| PubChem CID | 63617901 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-(6-methylthieno[2,3-d]pyrimidin-4-yl)oxycyclohexan-1-amine |
| SMILES | Cc1cc2c(OC3CCC(N)CC3)ncnc2s1 |
| InChI | InChI=1S/C13H17N3OS/c1-8-6-11-12(15-7-16-13(11)18-8)17-10-4-2-9(14)3-5-10/h6-7,9-10H,2-5,14H2,1H3 |
| InChIKey | VBEVHTFGOSRJEY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |