C19H29NO3 — CID 141420247
5-[benzyl(pentan-3-yl)amino]-2,2-dimethyl-5-oxopentanoic acid (PubChem CID 141420247) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 5-[benzyl(pentan-3-yl)amino]-2,2-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[benzyl(pentan-3-yl)amino]-2,2-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 141420247 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 5-[benzyl(pentan-3-yl)amino]-2,2-dimethyl-5-oxopentanoic acid |
| SMILES | CCC(CC)N(Cc1ccccc1)C(=O)CCC(C)(C)C(=O)O |
| InChI | InChI=1S/C19H29NO3/c1-5-16(6-2)20(14-15-10-8-7-9-11-15)17(21)12-13-19(3,4)18(22)23/h7-11,16H,5-6,12-14H2,1-4H3,(H,22,23) |
| InChIKey | JXRJKQRPKJQTBJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |