C14H19NO3 — CID 141420654
(3R)-4-[(1R)-1-hydroxyethyl]-3-[(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 141420654) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (3R)-4-[(1R)-1-hydroxyethyl]-3-[(4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | (3R)-4-[(1R)-1-hydroxyethyl]-3-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141420654 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (3R)-4-[(1R)-1-hydroxyethyl]-3-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C[C@H]2C(=O)NCC2[C@@H](C)O)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-9(16)13-8-15-14(17)12(13)7-10-3-5-11(18-2)6-4-10/h3-6,9,12-13,16H,7-8H2,1-2H3,(H,15,17)/t9-,12-,13?/m1/s1 |
| InChIKey | FXXNVPJQRZJMMU-PDFXSYEUSA-N |
| XLogP | 0.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |