C24H23ClN8 — CID 141422152
2-N-(3-chloro-4-piperazin-1-ylphenyl)-4-N-(2-pyridin-2-yl-3-pyridinyl)pyrimidine-2,4-diamine (PubChem CID 141422152) has the molecular formula C24H23ClN8 and a molecular weight of 458.96 g/mol. Its IUPAC name is 2-N-(3-chloro-4-piperazin-1-ylphenyl)-4-N-(2-pyridin-2-yl-3-pyridinyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-chloro-4-piperazin-1-ylphenyl)-4-N-(2-pyridin-2-yl-3-pyridinyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141422152 |
| Molecular Formula | C24H23ClN8 |
| Molecular Weight | 458.96 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-N-(3-chloro-4-piperazin-1-ylphenyl)-4-N-(2-pyridin-2-yl-3-pyridinyl)pyrimidine-2,4-diamine |
| SMILES | Clc1cc(Nc2nccc(Nc3cccnc3-c3ccccn3)n2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C24H23ClN8/c25-18-16-17(6-7-21(18)33-14-12-26-13-15-33)30-24-29-11-8-22(32-24)31-20-5-3-10-28-23(20)19-4-1-2-9-27-19/h1-11,16,26H,12-15H2,(H2,29,30,31,32) |
| InChIKey | VWZILFZABRYEOT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.96 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|