C25H31Br3 — CID 141422780
1-bromo-9,9-bis(1-bromohexyl)fluorene (PubChem CID 141422780) has the molecular formula C25H31Br3 and a molecular weight of 571.24 g/mol. Its IUPAC name is 1-bromo-9,9-bis(1-bromohexyl)fluorene.
| Compound Name | 1-bromo-9,9-bis(1-bromohexyl)fluorene |
|---|---|
| PubChem CID | 141422780 |
| Molecular Formula | C25H31Br3 |
| Molecular Weight | 571.24 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | 1-bromo-9,9-bis(1-bromohexyl)fluorene |
| SMILES | CCCCCC(Br)C1(C(Br)CCCCC)c2ccccc2-c2cccc(Br)c21 |
| InChI | InChI=1S/C25H31Br3/c1-3-5-7-16-22(27)25(23(28)17-8-6-4-2)20-14-10-9-12-18(20)19-13-11-15-21(26)24(19)25/h9-15,22-23H,3-8,16-17H2,1-2H3 |
| InChIKey | PMURKARKQVHTOM-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.24 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|