C30H20Br2O — CID 141425139
1,1-bis(4-bromophenyl)-3-[2-[2-(4-methylphenyl)ethynyl]phenyl]prop-2-yn-1-ol (PubChem CID 141425139) has the molecular formula C30H20Br2O and a molecular weight of 556.30 g/mol. Its IUPAC name is 1,1-bis(4-bromophenyl)-3-[2-[2-(4-methylphenyl)ethynyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 1,1-bis(4-bromophenyl)-3-[2-[2-(4-methylphenyl)ethynyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 141425139 |
| Molecular Formula | C30H20Br2O |
| Molecular Weight | 556.30 g/mol |
| Exact Mass | 553.99 |
| IUPAC Name | 1,1-bis(4-bromophenyl)-3-[2-[2-(4-methylphenyl)ethynyl]phenyl]prop-2-yn-1-ol |
| SMILES | Cc1ccc(C#Cc2ccccc2C#CC(O)(c2ccc(Br)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C30H20Br2O/c1-22-6-8-23(9-7-22)10-11-24-4-2-3-5-25(24)20-21-30(33,26-12-16-28(31)17-13-26)27-14-18-29(32)19-15-27/h2-9,12-19,33H,1H3 |
| InChIKey | DEFGCVGVGAZLDI-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.30 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|