C28H22O — CID 176908101
1,5-bis(4-methylphenyl)-3-(2-prop-1-ynylphenyl)penta-1,4-diyn-3-ol (PubChem CID 176908101) has the molecular formula C28H22O and a molecular weight of 374.48 g/mol. Its IUPAC name is 1,5-bis(4-methylphenyl)-3-(2-prop-1-ynylphenyl)penta-1,4-diyn-3-ol.
| Compound Name | 1,5-bis(4-methylphenyl)-3-(2-prop-1-ynylphenyl)penta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 176908101 |
| Molecular Formula | C28H22O |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1,5-bis(4-methylphenyl)-3-(2-prop-1-ynylphenyl)penta-1,4-diyn-3-ol |
| SMILES | CC#Cc1ccccc1C(O)(C#Cc1ccc(C)cc1)C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C28H22O/c1-4-7-26-8-5-6-9-27(26)28(29,20-18-24-14-10-22(2)11-15-24)21-19-25-16-12-23(3)13-17-25/h5-6,8-17,29H,1-3H3 |
| InChIKey | HAZLKQWTXRWJOZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|