C17H15N3O5S — CID 1414261
4-(5-ethylsulfonyl-2-hydroxyanilino)quinazoline-7-carboxylic acid (PubChem CID 1414261) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is 4-(5-ethylsulfonyl-2-hydroxyanilino)quinazoline-7-carboxylic acid.
| Compound Name | 4-(5-ethylsulfonyl-2-hydroxyanilino)quinazoline-7-carboxylic acid |
|---|---|
| PubChem CID | 1414261 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-(5-ethylsulfonyl-2-hydroxyanilino)quinazoline-7-carboxylic acid |
| SMILES | CCS(=O)(=O)c1ccc(O)c(Nc2ncnc3cc(C(=O)O)ccc23)c1 |
| InChI | InChI=1S/C17H15N3O5S/c1-2-26(24,25)11-4-6-15(21)14(8-11)20-16-12-5-3-10(17(22)23)7-13(12)18-9-19-16/h3-9,21H,2H2,1H3,(H,22,23)(H,18,19,20) |
| InChIKey | ZTFPTVOZGWZWPR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|