C21H19F6N3O6S — CID 162041782
N-[5-ethylsulfonyl-2-(trifluoromethoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine;2,2,2-trifluoroacetaldehyde (PubChem CID 162041782) has the molecular formula C21H19F6N3O6S and a molecular weight of 555.45 g/mol. Its IUPAC name is N-[5-ethylsulfonyl-2-(trifluoromethoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine;2,2,2-trifluoroacetaldehyde.
| Compound Name | N-[5-ethylsulfonyl-2-(trifluoromethoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 162041782 |
| Molecular Formula | C21H19F6N3O6S |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | N-[5-ethylsulfonyl-2-(trifluoromethoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine;2,2,2-trifluoroacetaldehyde |
| SMILES | CCS(=O)(=O)c1ccc(OC(F)(F)F)c(Nc2ncnc3cc(OC)c(OC)cc23)c1.O=CC(F)(F)F |
| InChI | InChI=1S/C19H18F3N3O5S.C2HF3O/c1-4-31(26,27)11-5-6-15(30-19(20,21)22)14(7-11)25-18-12-8-16(28-2)17(29-3)9-13(12)23-10-24-18;3-2(4,5)1-6/h5-10H,4H2,1-3H3,(H,23,24,25);1H |
| InChIKey | YXJJVUQTZPWKHS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|