C7H13N3 — CID 141427119
1,2,3,4,4a,7,8,8a-octahydro-1,2,3-benzotriazine (PubChem CID 141427119) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,2,3,4,4a,7,8,8a-octahydro-1,2,3-benzotriazine.
| Compound Name | 1,2,3,4,4a,7,8,8a-octahydro-1,2,3-benzotriazine |
|---|---|
| PubChem CID | 141427119 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 1,2,3,4,4a,7,8,8a-octahydro-1,2,3-benzotriazine |
| SMILES | C1=CC2CNNNC2CC1 |
| InChI | InChI=1S/C7H13N3/c1-2-4-7-6(3-1)5-8-10-9-7/h1,3,6-10H,2,4-5H2 |
| InChIKey | HLVZXPZQQNJSBH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|