C21H26O2 — CID 141427218
1-cyclopropyl-1-(2-phenylmethoxy-3-propan-2-ylphenyl)ethanol (PubChem CID 141427218) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-cyclopropyl-1-(2-phenylmethoxy-3-propan-2-ylphenyl)ethanol.
| Compound Name | 1-cyclopropyl-1-(2-phenylmethoxy-3-propan-2-ylphenyl)ethanol |
|---|---|
| PubChem CID | 141427218 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-cyclopropyl-1-(2-phenylmethoxy-3-propan-2-ylphenyl)ethanol |
| SMILES | CC(C)c1cccc(C(C)(O)C2CC2)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H26O2/c1-15(2)18-10-7-11-19(21(3,22)17-12-13-17)20(18)23-14-16-8-5-4-6-9-16/h4-11,15,17,22H,12-14H2,1-3H3 |
| InChIKey | JDQHRVIFMBXBCN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |