C51H54O3 — CID 174662245
2,4-bis[3-(3-tert-butyl-2-phenylmethoxyphenyl)phenyl]pentan-3-one (PubChem CID 174662245) has the molecular formula C51H54O3 and a molecular weight of 714.99 g/mol. Its IUPAC name is 2,4-bis[3-(3-tert-butyl-2-phenylmethoxyphenyl)phenyl]pentan-3-one.
| Compound Name | 2,4-bis[3-(3-tert-butyl-2-phenylmethoxyphenyl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 174662245 |
| Molecular Formula | C51H54O3 |
| Molecular Weight | 714.99 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | 2,4-bis[3-(3-tert-butyl-2-phenylmethoxyphenyl)phenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1cccc(-c2cccc(C(C)(C)C)c2OCc2ccccc2)c1)c1cccc(-c2cccc(C(C)(C)C)c2OCc2ccccc2)c1 |
| InChI | InChI=1S/C51H54O3/c1-35(39-23-15-25-41(31-39)43-27-17-29-45(50(3,4)5)48(43)53-33-37-19-11-9-12-20-37)47(52)36(2)40-24-16-26-42(32-40)44-28-18-30-46(51(6,7)8)49(44)54-34-38-21-13-10-14-22-38/h9-32,35-36H,33-34H2,1-8H3 |
| InChIKey | UEMXKDFYMALXIA-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.99 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |