C22H15F12NO — CID 141427494
(7aR)-1,1-bis[3,5-bis(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 141427494) has the molecular formula C22H15F12NO and a molecular weight of 537.34 g/mol. Its IUPAC name is (7aR)-1,1-bis[3,5-bis(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (7aR)-1,1-bis[3,5-bis(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 141427494 |
| Molecular Formula | C22H15F12NO |
| Molecular Weight | 537.34 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | (7aR)-1,1-bis[3,5-bis(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)cc(C2(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)OCN3CCC[C@@H]32)c1 |
| InChI | InChI=1S/C22H15F12NO/c23-19(24,25)13-4-11(5-14(8-13)20(26,27)28)18(17-2-1-3-35(17)10-36-18)12-6-15(21(29,30)31)9-16(7-12)22(32,33)34/h4-9,17H,1-3,10H2/t17-/m1/s1 |
| InChIKey | UVTDFTBPHCSQLB-QGZVFWFLSA-N |
| XLogP | 7.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.34 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |