C14H19N3 — CID 141427495
1-methyl-3-[(1-methylimidazolidin-4-yl)methyl]indole (PubChem CID 141427495) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 1-methyl-3-[(1-methylimidazolidin-4-yl)methyl]indole.
| Compound Name | 1-methyl-3-[(1-methylimidazolidin-4-yl)methyl]indole |
|---|---|
| PubChem CID | 141427495 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-methyl-3-[(1-methylimidazolidin-4-yl)methyl]indole |
| SMILES | CN1CNC(Cc2cn(C)c3ccccc23)C1 |
| InChI | InChI=1S/C14H19N3/c1-16-9-12(15-10-16)7-11-8-17(2)14-6-4-3-5-13(11)14/h3-6,8,12,15H,7,9-10H2,1-2H3 |
| InChIKey | LZSGMKRFZYDZBN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |