C27H23N3S — CID 134153382
(6S)-6-[(1-methylindol-3-yl)methyl]-2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 134153382) has the molecular formula C27H23N3S and a molecular weight of 421.57 g/mol. Its IUPAC name is (6S)-6-[(1-methylindol-3-yl)methyl]-2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (6S)-6-[(1-methylindol-3-yl)methyl]-2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 134153382 |
| Molecular Formula | C27H23N3S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (6S)-6-[(1-methylindol-3-yl)methyl]-2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cn1cc(C[C@H]2CN3C(=N2)SC(c2ccccc2)=C3c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H23N3S/c1-29-17-21(23-14-8-9-15-24(23)29)16-22-18-30-25(19-10-4-2-5-11-19)26(31-27(30)28-22)20-12-6-3-7-13-20/h2-15,17,22H,16,18H2,1H3/t22-/m0/s1 |
| InChIKey | IWNAFTRZAZMNHY-QFIPXVFZSA-N |
| XLogP | 6.03 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|