C14H15N3OS — CID 136502439
2-methylimino-5-[(1-methylindol-3-yl)methyl]-1,3-thiazolidin-4-one (PubChem CID 136502439) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-methylimino-5-[(1-methylindol-3-yl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-methylimino-5-[(1-methylindol-3-yl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136502439 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-methylimino-5-[(1-methylindol-3-yl)methyl]-1,3-thiazolidin-4-one |
| SMILES | C/N=C1\NC(=O)C(Cc2cn(C)c3ccccc23)S1 |
| InChI | InChI=1S/C14H15N3OS/c1-15-14-16-13(18)12(19-14)7-9-8-17(2)11-6-4-3-5-10(9)11/h3-6,8,12H,7H2,1-2H3,(H,15,16,18) |
| InChIKey | CLTHVNWMIMXJBF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|