C12H23ClN2O2 — CID 141429352
ethyl-methyl-(oxiran-2-ylmethyl)-[3-(prop-2-enoylamino)propyl]azanium chloride (PubChem CID 141429352) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is ethyl-methyl-(oxiran-2-ylmethyl)-[3-(prop-2-enoylamino)propyl]azanium chloride.
| Compound Name | ethyl-methyl-(oxiran-2-ylmethyl)-[3-(prop-2-enoylamino)propyl]azanium chloride |
|---|---|
| PubChem CID | 141429352 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | ethyl-methyl-(oxiran-2-ylmethyl)-[3-(prop-2-enoylamino)propyl]azanium chloride |
| SMILES | C=CC(=O)NCCC[N+](C)(CC)CC1CO1.[Cl-] |
| InChI | InChI=1S/C12H22N2O2.ClH/c1-4-12(15)13-7-6-8-14(3,5-2)9-11-10-16-11;/h4,11H,1,5-10H2,2-3H3;1H |
| InChIKey | SYFLUBBTQNVNNZ-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|