C11H21ClN2O2 — CID 19707560
dimethyl-[oxiran-2-yl-(prop-2-enoylamino)methyl]-propylazanium chloride (PubChem CID 19707560) has the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. Its IUPAC name is dimethyl-[oxiran-2-yl-(prop-2-enoylamino)methyl]-propylazanium chloride.
| Compound Name | dimethyl-[oxiran-2-yl-(prop-2-enoylamino)methyl]-propylazanium chloride |
|---|---|
| PubChem CID | 19707560 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | dimethyl-[oxiran-2-yl-(prop-2-enoylamino)methyl]-propylazanium chloride |
| SMILES | C=CC(=O)NC(C1CO1)[N+](C)(C)CCC.[Cl-] |
| InChI | InChI=1S/C11H20N2O2.ClH/c1-5-7-13(3,4)11(9-8-15-9)12-10(14)6-2;/h6,9,11H,2,5,7-8H2,1,3-4H3;1H |
| InChIKey | NTULNBNENTUVBK-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|