C8H12O9 — CID 141429477
2-(1,4,5,5,6,6-hexahydroxycyclohex-2-en-1-yl)-2-hydroxyacetic acid (PubChem CID 141429477) has the molecular formula C8H12O9 and a molecular weight of 252.17 g/mol. Its IUPAC name is 2-(1,4,5,5,6,6-hexahydroxycyclohex-2-en-1-yl)-2-hydroxyacetic acid.
| Compound Name | 2-(1,4,5,5,6,6-hexahydroxycyclohex-2-en-1-yl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 141429477 |
| Molecular Formula | C8H12O9 |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-(1,4,5,5,6,6-hexahydroxycyclohex-2-en-1-yl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)C1(O)C=CC(O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C8H12O9/c9-3-1-2-6(13,4(10)5(11)12)8(16,17)7(3,14)15/h1-4,9-10,13-17H,(H,11,12) |
| InChIKey | GAHZTKZRNXMBSY-UHFFFAOYSA-N |
| XLogP | -4.54 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|