C11H10F6N2 — CID 141429912
2-(trifluoromethyl)-4-[3-(trifluoromethyl)pyrrolidin-3-yl]pyridine (PubChem CID 141429912) has the molecular formula C11H10F6N2 and a molecular weight of 284.20 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-[3-(trifluoromethyl)pyrrolidin-3-yl]pyridine.
| Compound Name | 2-(trifluoromethyl)-4-[3-(trifluoromethyl)pyrrolidin-3-yl]pyridine |
|---|---|
| PubChem CID | 141429912 |
| Molecular Formula | C11H10F6N2 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-(trifluoromethyl)-4-[3-(trifluoromethyl)pyrrolidin-3-yl]pyridine |
| SMILES | FC(F)(F)c1cc(C2(C(F)(F)F)CCNC2)ccn1 |
| InChI | InChI=1S/C11H10F6N2/c12-10(13,14)8-5-7(1-3-19-8)9(11(15,16)17)2-4-18-6-9/h1,3,5,18H,2,4,6H2 |
| InChIKey | MQNYKFRSWKACNQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |