1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid

C12H9NO3 — CID 141431663

IUPAC1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid
SMILESO=C(O)c1cccc2c3c(cnc12)OCC3
InChIInChI=1S/C12H9NO3/c14-12(15)9-3-1-2-8-7-4-5-16-10(7)6-13-11(8)9/h1-3,6H,4-5H2,(H,14,15)
InChIKeyGWPBWHXEPIUXGD-UHFFFAOYSA-N
MW215.21 g/mol
LogP1.87
Rot. Bonds1

About 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid

1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid (PubChem CID 141431663) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid.

Molecular Properties

Compound Name1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid
PubChem CID141431663
Molecular FormulaC12H9NO3
Molecular Weight215.21 g/mol
Exact Mass215.06
IUPAC Name1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid
SMILESO=C(O)c1cccc2c3c(cnc12)OCC3
InChIInChI=1S/C12H9NO3/c14-12(15)9-3-1-2-8-7-4-5-16-10(7)6-13-11(8)9/h1-3,6H,4-5H2,(H,14,15)
InChIKeyGWPBWHXEPIUXGD-UHFFFAOYSA-N
XLogP1.87
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.21
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid?
The IUPAC name of 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid (CID 141431663) is 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid.
What is the SMILES notation for 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid?
The canonical SMILES for 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid is O=C(O)c1cccc2c3c(cnc12)OCC3.
What is the InChIKey of 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid?
The InChIKey is GWPBWHXEPIUXGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3/c14-12(15)9-3-1-2-8-7-4-5-16-10(7)6-13-11(8)9/h1-3,6H,4-5H2,(H,14,15).
What are the key properties of 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid?
1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid has a molecular weight of 215.21 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrofuro[2,3-c]quinoline-6-carboxylic acid is sourced from PubChem (CID 141431663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).