C22H22 — CID 141432591
4-[2-(2-butylphenyl)ethynyl]-2-methyl-1-prop-1-ynylbenzene (PubChem CID 141432591) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-[2-(2-butylphenyl)ethynyl]-2-methyl-1-prop-1-ynylbenzene.
| Compound Name | 4-[2-(2-butylphenyl)ethynyl]-2-methyl-1-prop-1-ynylbenzene |
|---|---|
| PubChem CID | 141432591 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 4-[2-(2-butylphenyl)ethynyl]-2-methyl-1-prop-1-ynylbenzene |
| SMILES | CC#Cc1ccc(C#Cc2ccccc2CCCC)cc1C |
| InChI | InChI=1S/C22H22/c1-4-6-10-21-11-7-8-12-22(21)16-14-19-13-15-20(9-5-2)18(3)17-19/h7-8,11-13,15,17H,4,6,10H2,1-3H3 |
| InChIKey | KIGILGIEUZYYOB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|