C15H12ClN5O — CID 141433603
(4-aminopyrimidin-5-yl)-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]methanone (PubChem CID 141433603) has the molecular formula C15H12ClN5O and a molecular weight of 313.75 g/mol. Its IUPAC name is (4-aminopyrimidin-5-yl)-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]methanone.
| Compound Name | (4-aminopyrimidin-5-yl)-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 141433603 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (4-aminopyrimidin-5-yl)-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]methanone |
| SMILES | Nc1ncncc1C(=O)c1ccn(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H12ClN5O/c16-12-4-2-1-3-10(12)8-21-6-5-13(20-21)14(22)11-7-18-9-19-15(11)17/h1-7,9H,8H2,(H2,17,18,19) |
| InChIKey | QEJAXXKZCVIJIW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |