C19H22N2O10S — CID 141434079
triethyl 1-(benzenesulfonyl)-3-nitro-3H-pyrrole-2,2,4-tricarboxylate (PubChem CID 141434079) has the molecular formula C19H22N2O10S and a molecular weight of 470.46 g/mol. Its IUPAC name is triethyl 1-(benzenesulfonyl)-3-nitro-3H-pyrrole-2,2,4-tricarboxylate.
| Compound Name | triethyl 1-(benzenesulfonyl)-3-nitro-3H-pyrrole-2,2,4-tricarboxylate |
|---|---|
| PubChem CID | 141434079 |
| Molecular Formula | C19H22N2O10S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | triethyl 1-(benzenesulfonyl)-3-nitro-3H-pyrrole-2,2,4-tricarboxylate |
| SMILES | CCOC(=O)C1=CN(S(=O)(=O)c2ccccc2)C(C(=O)OCC)(C(=O)OCC)C1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N2O10S/c1-4-29-16(22)14-12-20(32(27,28)13-10-8-7-9-11-13)19(15(14)21(25)26,17(23)30-5-2)18(24)31-6-3/h7-12,15H,4-6H2,1-3H3 |
| InChIKey | QCNMWDCYIWSKNF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 159.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|