C23H32 — CID 141434105
2,4-dibutyl-1-(2-phenylpropyl)benzene (PubChem CID 141434105) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2,4-dibutyl-1-(2-phenylpropyl)benzene.
| Compound Name | 2,4-dibutyl-1-(2-phenylpropyl)benzene |
|---|---|
| PubChem CID | 141434105 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2,4-dibutyl-1-(2-phenylpropyl)benzene |
| SMILES | CCCCc1ccc(CC(C)c2ccccc2)c(CCCC)c1 |
| InChI | InChI=1S/C23H32/c1-4-6-11-20-15-16-23(22(18-20)12-7-5-2)17-19(3)21-13-9-8-10-14-21/h8-10,13-16,18-19H,4-7,11-12,17H2,1-3H3 |
| InChIKey | DWISRIBFBVEEQF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |