C19H19N3O2 — CID 141434982
3-[3-[ethyl(quinoxalin-2-yl)amino]phenyl]propanoic acid (PubChem CID 141434982) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-[3-[ethyl(quinoxalin-2-yl)amino]phenyl]propanoic acid.
| Compound Name | 3-[3-[ethyl(quinoxalin-2-yl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 141434982 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-[3-[ethyl(quinoxalin-2-yl)amino]phenyl]propanoic acid |
| SMILES | CCN(c1cccc(CCC(=O)O)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C19H19N3O2/c1-2-22(15-7-5-6-14(12-15)10-11-19(23)24)18-13-20-16-8-3-4-9-17(16)21-18/h3-9,12-13H,2,10-11H2,1H3,(H,23,24) |
| InChIKey | JJTIGKGVMGGAOE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |