C19H15N5O2 — CID 141435932
6-phenyl-3-(2-pyrimidin-2-yloxyethyl)-1,2,3-benzotriazin-4-one (PubChem CID 141435932) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 6-phenyl-3-(2-pyrimidin-2-yloxyethyl)-1,2,3-benzotriazin-4-one.
| Compound Name | 6-phenyl-3-(2-pyrimidin-2-yloxyethyl)-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 141435932 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 6-phenyl-3-(2-pyrimidin-2-yloxyethyl)-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2cc(-c3ccccc3)ccc2nnn1CCOc1ncccn1 |
| InChI | InChI=1S/C19H15N5O2/c25-18-16-13-15(14-5-2-1-3-6-14)7-8-17(16)22-23-24(18)11-12-26-19-20-9-4-10-21-19/h1-10,13H,11-12H2 |
| InChIKey | OVIYVXJFCXLBNE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |