C18H12F3N3O2 — CID 89154320
3-but-3-ynyl-6-[4-(trifluoromethoxy)phenyl]-1,2,3-benzotriazin-4-one (PubChem CID 89154320) has the molecular formula C18H12F3N3O2 and a molecular weight of 359.31 g/mol. Its IUPAC name is 3-but-3-ynyl-6-[4-(trifluoromethoxy)phenyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-but-3-ynyl-6-[4-(trifluoromethoxy)phenyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 89154320 |
| Molecular Formula | C18H12F3N3O2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-but-3-ynyl-6-[4-(trifluoromethoxy)phenyl]-1,2,3-benzotriazin-4-one |
| SMILES | C#CCCn1nnc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2c1=O |
| InChI | InChI=1S/C18H12F3N3O2/c1-2-3-10-24-17(25)15-11-13(6-9-16(15)22-23-24)12-4-7-14(8-5-12)26-18(19,20)21/h1,4-9,11H,3,10H2 |
| InChIKey | MNHBHURRJPAISL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|