C25H18F3N3O2 — CID 176910401
3-[2-(1H-indol-3-yl)ethyl]-6-[4-(trifluoromethoxy)phenyl]quinazolin-4-one (PubChem CID 176910401) has the molecular formula C25H18F3N3O2 and a molecular weight of 449.43 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)ethyl]-6-[4-(trifluoromethoxy)phenyl]quinazolin-4-one.
| Compound Name | 3-[2-(1H-indol-3-yl)ethyl]-6-[4-(trifluoromethoxy)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 176910401 |
| Molecular Formula | C25H18F3N3O2 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)ethyl]-6-[4-(trifluoromethoxy)phenyl]quinazolin-4-one |
| SMILES | O=c1c2cc(-c3ccc(OC(F)(F)F)cc3)ccc2ncn1CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H18F3N3O2/c26-25(27,28)33-19-8-5-16(6-9-19)17-7-10-23-21(13-17)24(32)31(15-30-23)12-11-18-14-29-22-4-2-1-3-20(18)22/h1-10,13-15,29H,11-12H2 |
| InChIKey | DCERFWAXYNOYLQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |