C33H33N7OS — CID 176910405
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[3-[2-(1H-indol-3-yl)ethyl]-4-oxoquinazolin-6-yl]thiourea (PubChem CID 176910405) has the molecular formula C33H33N7OS and a molecular weight of 575.74 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[3-[2-(1H-indol-3-yl)ethyl]-4-oxoquinazolin-6-yl]thiourea.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[3-[2-(1H-indol-3-yl)ethyl]-4-oxoquinazolin-6-yl]thiourea |
|---|---|
| PubChem CID | 176910405 |
| Molecular Formula | C33H33N7OS |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[3-[2-(1H-indol-3-yl)ethyl]-4-oxoquinazolin-6-yl]thiourea |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=S)Nc2ccc3ncn(CCc4c[nH]c5ccccc45)c(=O)c3c2)cc1 |
| InChI | InChI=1S/C33H33N7OS/c1-21-9-12-24(13-10-21)40-30(18-29(38-40)33(2,3)4)37-32(42)36-23-11-14-28-26(17-23)31(41)39(20-35-28)16-15-22-19-34-27-8-6-5-7-25(22)27/h5-14,17-20,34H,15-16H2,1-4H3,(H2,36,37,42) |
| InChIKey | SDVUGDBWNXWCFU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|