C26H21N3O3 — CID 176910375
methyl 4-[3-[2-(1H-indol-3-yl)ethyl]-4-oxoquinazolin-6-yl]benzoate (PubChem CID 176910375) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 4-[3-[2-(1H-indol-3-yl)ethyl]-4-oxoquinazolin-6-yl]benzoate.
| Compound Name | methyl 4-[3-[2-(1H-indol-3-yl)ethyl]-4-oxoquinazolin-6-yl]benzoate |
|---|---|
| PubChem CID | 176910375 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | methyl 4-[3-[2-(1H-indol-3-yl)ethyl]-4-oxoquinazolin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc3ncn(CCc4c[nH]c5ccccc45)c(=O)c3c2)cc1 |
| InChI | InChI=1S/C26H21N3O3/c1-32-26(31)18-8-6-17(7-9-18)19-10-11-24-22(14-19)25(30)29(16-28-24)13-12-20-15-27-23-5-3-2-4-21(20)23/h2-11,14-16,27H,12-13H2,1H3 |
| InChIKey | HJDZJNMVSJUEDA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |