C30H26N2O5 — CID 123998211
methyl 4-[1-[2-(1H-indol-3-yl)ethyl]-3-(3-methylbenzoyl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 123998211) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is methyl 4-[1-[2-(1H-indol-3-yl)ethyl]-3-(3-methylbenzoyl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[1-[2-(1H-indol-3-yl)ethyl]-3-(3-methylbenzoyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 123998211 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | methyl 4-[1-[2-(1H-indol-3-yl)ethyl]-3-(3-methylbenzoyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C(=O)c3cccc(C)c3)C(=O)C(=O)N2CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C30H26N2O5/c1-18-6-5-7-21(16-18)27(33)25-26(19-10-12-20(13-11-19)30(36)37-2)32(29(35)28(25)34)15-14-22-17-31-24-9-4-3-8-23(22)24/h3-13,16-17,25-26,31H,14-15H2,1-2H3 |
| InChIKey | WWFBPCMKDDNVJM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|