C19H20N2O — CID 11493048
N-[2-(1H-indol-3-yl)ethyl]-N,3-dimethylbenzamide (PubChem CID 11493048) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N,3-dimethylbenzamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 11493048 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)CCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C19H20N2O/c1-14-6-5-7-15(12-14)19(22)21(2)11-10-16-13-20-18-9-4-3-8-17(16)18/h3-9,12-13,20H,10-11H2,1-2H3 |
| InChIKey | NYQHZXRCLMHVOA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |