C31H27F6N3O2 — CID 11556112
3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-N-methylbenzamide (PubChem CID 11556112) has the molecular formula C31H27F6N3O2 and a molecular weight of 587.56 g/mol. Its IUPAC name is 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-N-methylbenzamide.
| Compound Name | 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 11556112 |
| Molecular Formula | C31H27F6N3O2 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-N-methylbenzamide |
| SMILES | Cc1cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2n1Cc1cccc(C(=O)N(C)CCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C31H27F6N3O2/c1-19-14-23-16-24(29(42,30(32,33)34)31(35,36)37)10-11-27(23)40(19)18-20-6-5-7-21(15-20)28(41)39(2)13-12-22-17-38-26-9-4-3-8-25(22)26/h3-11,14-17,38,42H,12-13,18H2,1-2H3 |
| InChIKey | KZOOYWCZVJGEMB-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 61.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |