C24H18F2N4O3 — CID 141436022
N-[3-(2,4-difluorophenyl)-5-[2-nitro-4-(1H-pyrrol-2-yl)anilino]phenyl]acetamide (PubChem CID 141436022) has the molecular formula C24H18F2N4O3 and a molecular weight of 448.43 g/mol. Its IUPAC name is N-[3-(2,4-difluorophenyl)-5-[2-nitro-4-(1H-pyrrol-2-yl)anilino]phenyl]acetamide.
| Compound Name | N-[3-(2,4-difluorophenyl)-5-[2-nitro-4-(1H-pyrrol-2-yl)anilino]phenyl]acetamide |
|---|---|
| PubChem CID | 141436022 |
| Molecular Formula | C24H18F2N4O3 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-[3-(2,4-difluorophenyl)-5-[2-nitro-4-(1H-pyrrol-2-yl)anilino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Nc2ccc(-c3ccc[nH]3)cc2[N+](=O)[O-])cc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C24H18F2N4O3/c1-14(31)28-18-9-16(20-6-5-17(25)12-21(20)26)10-19(13-18)29-23-7-4-15(11-24(23)30(32)33)22-3-2-8-27-22/h2-13,27,29H,1H3,(H,28,31) |
| InChIKey | GVTHXTNFGWTJQP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|