C21H34N2O5 — CID 141436857
ethyl 3-[methyl-[2-[2-[2-(1,2,3,4-tetrahydroquinolin-6-yloxy)ethoxy]ethoxy]ethyl]amino]propanoate (PubChem CID 141436857) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is ethyl 3-[methyl-[2-[2-[2-(1,2,3,4-tetrahydroquinolin-6-yloxy)ethoxy]ethoxy]ethyl]amino]propanoate.
| Compound Name | ethyl 3-[methyl-[2-[2-[2-(1,2,3,4-tetrahydroquinolin-6-yloxy)ethoxy]ethoxy]ethyl]amino]propanoate |
|---|---|
| PubChem CID | 141436857 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethyl 3-[methyl-[2-[2-[2-(1,2,3,4-tetrahydroquinolin-6-yloxy)ethoxy]ethoxy]ethyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(C)CCOCCOCCOc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C21H34N2O5/c1-3-27-21(24)8-10-23(2)11-12-25-13-14-26-15-16-28-19-6-7-20-18(17-19)5-4-9-22-20/h6-7,17,22H,3-5,8-16H2,1-2H3 |
| InChIKey | HIQVWQOAXBAVBQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|