C10H15NO6S2 — CID 141437043
1-(3-methylsulfonyloxy-2-pyridinyl)butane-1-sulfonic acid (PubChem CID 141437043) has the molecular formula C10H15NO6S2 and a molecular weight of 309.36 g/mol. Its IUPAC name is 1-(3-methylsulfonyloxy-2-pyridinyl)butane-1-sulfonic acid.
| Compound Name | 1-(3-methylsulfonyloxy-2-pyridinyl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 141437043 |
| Molecular Formula | C10H15NO6S2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 1-(3-methylsulfonyloxy-2-pyridinyl)butane-1-sulfonic acid |
| SMILES | CCCC(c1ncccc1OS(C)(=O)=O)S(=O)(=O)O |
| InChI | InChI=1S/C10H15NO6S2/c1-3-5-9(19(14,15)16)10-8(6-4-7-11-10)17-18(2,12)13/h4,6-7,9H,3,5H2,1-2H3,(H,14,15,16) |
| InChIKey | DQNWZWSTEYCLTR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|