C8H5BrFN3O — CID 141437142
2-bromo-1-(6-fluoroimidazo[1,2-b]pyridazin-3-yl)ethanone (PubChem CID 141437142) has the molecular formula C8H5BrFN3O and a molecular weight of 258.05 g/mol. Its IUPAC name is 2-bromo-1-(6-fluoroimidazo[1,2-b]pyridazin-3-yl)ethanone.
| Compound Name | 2-bromo-1-(6-fluoroimidazo[1,2-b]pyridazin-3-yl)ethanone |
|---|---|
| PubChem CID | 141437142 |
| Molecular Formula | C8H5BrFN3O |
| Molecular Weight | 258.05 g/mol |
| Exact Mass | 256.96 |
| IUPAC Name | 2-bromo-1-(6-fluoroimidazo[1,2-b]pyridazin-3-yl)ethanone |
| SMILES | O=C(CBr)c1cnc2ccc(F)nn12 |
| InChI | InChI=1S/C8H5BrFN3O/c9-3-6(14)5-4-11-8-2-1-7(10)12-13(5)8/h1-2,4H,3H2 |
| InChIKey | XLLGZMLBRXAVJY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.05 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|