C16H14F2N4O2S — CID 141437589
N-(2,5-difluorophenyl)-4-(4-ethyltriazol-1-yl)benzenesulfonamide (PubChem CID 141437589) has the molecular formula C16H14F2N4O2S and a molecular weight of 364.38 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-(4-ethyltriazol-1-yl)benzenesulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-4-(4-ethyltriazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 141437589 |
| Molecular Formula | C16H14F2N4O2S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-(4-ethyltriazol-1-yl)benzenesulfonamide |
| SMILES | CCc1cn(-c2ccc(S(=O)(=O)Nc3cc(F)ccc3F)cc2)nn1 |
| InChI | InChI=1S/C16H14F2N4O2S/c1-2-12-10-22(21-19-12)13-4-6-14(7-5-13)25(23,24)20-16-9-11(17)3-8-15(16)18/h3-10,20H,2H2,1H3 |
| InChIKey | UOOPEMLJGXDEHX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |