C19H15F2N3O3S — CID 141468045
N-(2,5-difluorophenyl)-4-(2-oxo-1-prop-2-enylpyrimidin-5-yl)benzenesulfonamide (PubChem CID 141468045) has the molecular formula C19H15F2N3O3S and a molecular weight of 403.41 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-(2-oxo-1-prop-2-enylpyrimidin-5-yl)benzenesulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-4-(2-oxo-1-prop-2-enylpyrimidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 141468045 |
| Molecular Formula | C19H15F2N3O3S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-(2-oxo-1-prop-2-enylpyrimidin-5-yl)benzenesulfonamide |
| SMILES | C=CCn1cc(-c2ccc(S(=O)(=O)Nc3cc(F)ccc3F)cc2)cnc1=O |
| InChI | InChI=1S/C19H15F2N3O3S/c1-2-9-24-12-14(11-22-19(24)25)13-3-6-16(7-4-13)28(26,27)23-18-10-15(20)5-8-17(18)21/h2-8,10-12,23H,1,9H2 |
| InChIKey | RPTSOEHZLKATHO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|