C12H12N2O2S — CID 141438420
2-sulfanyl-1,2,3,4,4a,6a-hexahydrobenzo[h]quinazoline-5,6-dione (PubChem CID 141438420) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-sulfanyl-1,2,3,4,4a,6a-hexahydrobenzo[h]quinazoline-5,6-dione.
| Compound Name | 2-sulfanyl-1,2,3,4,4a,6a-hexahydrobenzo[h]quinazoline-5,6-dione |
|---|---|
| PubChem CID | 141438420 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-sulfanyl-1,2,3,4,4a,6a-hexahydrobenzo[h]quinazoline-5,6-dione |
| SMILES | O=C1C(=O)C2CNC(S)NC2=C2C=CC=CC12 |
| InChI | InChI=1S/C12H12N2O2S/c15-10-7-4-2-1-3-6(7)9-8(11(10)16)5-13-12(17)14-9/h1-4,7-8,12-14,17H,5H2 |
| InChIKey | MCYONFUQGFVDHX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|