C13H9N5 — CID 141438727
2,3-bis(1H-pyrazol-4-yl)benzonitrile (PubChem CID 141438727) has the molecular formula C13H9N5 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2,3-bis(1H-pyrazol-4-yl)benzonitrile.
| Compound Name | 2,3-bis(1H-pyrazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 141438727 |
| Molecular Formula | C13H9N5 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2,3-bis(1H-pyrazol-4-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2cn[nH]c2)c1-c1cn[nH]c1 |
| InChI | InChI=1S/C13H9N5/c14-4-9-2-1-3-12(10-5-15-16-6-10)13(9)11-7-17-18-8-11/h1-3,5-8H,(H,15,16)(H,17,18) |
| InChIKey | CAVSWICLXSDKFU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |