C12H12N2O — CID 137477380
4-(3,4-dihydro-1H-isochromen-5-yl)-1H-pyrazole (PubChem CID 137477380) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isochromen-5-yl)-1H-pyrazole.
| Compound Name | 4-(3,4-dihydro-1H-isochromen-5-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 137477380 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 4-(3,4-dihydro-1H-isochromen-5-yl)-1H-pyrazole |
| SMILES | c1cc2c(c(-c3cn[nH]c3)c1)CCOC2 |
| InChI | InChI=1S/C12H12N2O/c1-2-9-8-15-5-4-12(9)11(3-1)10-6-13-14-7-10/h1-3,6-7H,4-5,8H2,(H,13,14) |
| InChIKey | HBYIPQZXEKSVQN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |