C15H13FO — CID 171496490
8-(4-fluorophenyl)-3,4-dihydro-1H-isochromene (PubChem CID 171496490) has the molecular formula C15H13FO and a molecular weight of 228.27 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-3,4-dihydro-1H-isochromene.
| Compound Name | 8-(4-fluorophenyl)-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 171496490 |
| Molecular Formula | C15H13FO |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 8-(4-fluorophenyl)-3,4-dihydro-1H-isochromene |
| SMILES | Fc1ccc(-c2cccc3c2COCC3)cc1 |
| InChI | InChI=1S/C15H13FO/c16-13-6-4-12(5-7-13)14-3-1-2-11-8-9-17-10-15(11)14/h1-7H,8-10H2 |
| InChIKey | SULRDEZPTWAZDE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |